C13H23N — CID 67082324
4-pentyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine (PubChem CID 67082324) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 4-pentyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-pentyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 67082324 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 4-pentyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
| SMILES | C=CCC1CC(CCCCC)=CCN1 |
| InChI | InChI=1S/C13H23N/c1-3-5-6-8-12-9-10-14-13(11-12)7-4-2/h4,9,13-14H,2-3,5-8,10-11H2,1H3 |
| InChIKey | YEVCYFRUAVJOBP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|