C19H24F3NO4S2 — CID 67082748
2-[2-[(1R,5R)-2-oxo-5-[(E,4S)-7,7,7-trifluoro-4-hydroxy-4-methylhept-1-enyl]cyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 67082748) has the molecular formula C19H24F3NO4S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-[2-[(1R,5R)-2-oxo-5-[(E,4S)-7,7,7-trifluoro-4-hydroxy-4-methylhept-1-enyl]cyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(1R,5R)-2-oxo-5-[(E,4S)-7,7,7-trifluoro-4-hydroxy-4-methylhept-1-enyl]cyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67082748 |
| Molecular Formula | C19H24F3NO4S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-[2-[(1R,5R)-2-oxo-5-[(E,4S)-7,7,7-trifluoro-4-hydroxy-4-methylhept-1-enyl]cyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C[C@@](O)(C/C=C/[C@H]1CCC(=O)[C@@H]1CCSc1nc(C(=O)O)cs1)CCC(F)(F)F |
| InChI | InChI=1S/C19H24F3NO4S2/c1-18(27,8-9-19(20,21)22)7-2-3-12-4-5-15(24)13(12)6-10-28-17-23-14(11-29-17)16(25)26/h2-3,11-13,27H,4-10H2,1H3,(H,25,26)/b3-2+/t12-,13+,18+/m0/s1 |
| InChIKey | WQXORXCPXXDTAR-CMPKWODGSA-N |
| XLogP | 4.96 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|