About sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate
sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate (PubChem CID 67083304) has the molecular formula C4H4FNaO2
and a molecular weight of 126.06 g/mol. Its IUPAC name is sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate |
| PubChem CID | 67083304 |
| Molecular Formula | C4H4FNaO2 |
| Molecular Weight | 126.06 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate |
| SMILES | O=C([O-])[C@@H]1C[C@@H]1F.[Na+] |
| InChI | InChI=1S/C4H5FO2.Na/c5-3-1-2(3)4(6)7;/h2-3H,1H2,(H,6,7);/q;+1/p-1/t2-,3+;/m1./s1 |
| InChIKey | XCCVQIBTGQGCFI-MUWMCQJSSA-M |
| XLogP | -3.90 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.06 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate?
The IUPAC name of sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate (CID 67083304) is sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate.
What is the SMILES notation for sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate?
The canonical SMILES for sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate is O=C([O-])[C@@H]1C[C@@H]1F.[Na+].
What is the InChIKey of sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate?
The InChIKey is XCCVQIBTGQGCFI-MUWMCQJSSA-M. The full InChI is InChI=1S/C4H5FO2.Na/c5-3-1-2(3)4(6)7;/h2-3H,1H2,(H,6,7);/q;+1/p-1/t2-,3+;/m1./s1.
What are the key properties of sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate?
sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate has a molecular weight of 126.06 g/mol, XLogP of -3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate is sourced from PubChem (CID 67083304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).