About 1-(thiolan-2-yl)pyrrole
1-(thiolan-2-yl)pyrrole (PubChem CID 67083380) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 1-(thiolan-2-yl)pyrrole.
Molecular Properties
| Compound Name | 1-(thiolan-2-yl)pyrrole |
| PubChem CID | 67083380 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 1-(thiolan-2-yl)pyrrole |
| SMILES | c1ccn(C2CCCS2)c1 |
| InChI | InChI=1S/C8H11NS/c1-2-6-9(5-1)8-4-3-7-10-8/h1-2,5-6,8H,3-4,7H2 |
| InChIKey | UFDFLTWLYKSMHC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(thiolan-2-yl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(thiolan-2-yl)pyrrole?
The IUPAC name of 1-(thiolan-2-yl)pyrrole (CID 67083380) is 1-(thiolan-2-yl)pyrrole.
What is the SMILES notation for 1-(thiolan-2-yl)pyrrole?
The canonical SMILES for 1-(thiolan-2-yl)pyrrole is c1ccn(C2CCCS2)c1.
What is the InChIKey of 1-(thiolan-2-yl)pyrrole?
The InChIKey is UFDFLTWLYKSMHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-2-6-9(5-1)8-4-3-7-10-8/h1-2,5-6,8H,3-4,7H2.
What are the key properties of 1-(thiolan-2-yl)pyrrole?
1-(thiolan-2-yl)pyrrole has a molecular weight of 153.25 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(thiolan-2-yl)pyrrole is sourced from PubChem (CID 67083380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).