C20H34O12 — CID 67083419
dimethyl 2-(5-heptyl-3,4-dihydroxy-5-methoxy-2-methoxycarbonyloxolan-2-yl)-2,3-dihydroxybutanedioate (PubChem CID 67083419) has the molecular formula C20H34O12 and a molecular weight of 466.48 g/mol. Its IUPAC name is dimethyl 2-(5-heptyl-3,4-dihydroxy-5-methoxy-2-methoxycarbonyloxolan-2-yl)-2,3-dihydroxybutanedioate.
| Compound Name | dimethyl 2-(5-heptyl-3,4-dihydroxy-5-methoxy-2-methoxycarbonyloxolan-2-yl)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 67083419 |
| Molecular Formula | C20H34O12 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | dimethyl 2-(5-heptyl-3,4-dihydroxy-5-methoxy-2-methoxycarbonyloxolan-2-yl)-2,3-dihydroxybutanedioate |
| SMILES | CCCCCCCC1(OC)OC(C(=O)OC)(C(O)(C(=O)OC)C(O)C(=O)OC)C(O)C1O |
| InChI | InChI=1S/C20H34O12/c1-6-7-8-9-10-11-18(31-5)12(21)13(22)20(32-18,17(26)30-4)19(27,16(25)29-3)14(23)15(24)28-2/h12-14,21-23,27H,6-11H2,1-5H3 |
| InChIKey | FJCGVFDVHPHQRR-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|