C22H35NO3 — CID 6708353
(1S,2S,3R)-1-[4-(hydroxymethyl)phenyl]-2-methyl-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)butane-1,3-diol (PubChem CID 6708353) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (1S,2S,3R)-1-[4-(hydroxymethyl)phenyl]-2-methyl-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)butane-1,3-diol.
| Compound Name | (1S,2S,3R)-1-[4-(hydroxymethyl)phenyl]-2-methyl-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)butane-1,3-diol |
|---|---|
| PubChem CID | 6708353 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | (1S,2S,3R)-1-[4-(hydroxymethyl)phenyl]-2-methyl-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)butane-1,3-diol |
| SMILES | C[C@@H]([C@H](O)c1ccc(CO)cc1)[C@@H](O)CN1CC2(C)CC1CC(C)(C)C2 |
| InChI | InChI=1S/C22H35NO3/c1-15(20(26)17-7-5-16(12-24)6-8-17)19(25)11-23-14-22(4)10-18(23)9-21(2,3)13-22/h5-8,15,18-20,24-26H,9-14H2,1-4H3/t15-,18?,19+,20+,22?/m1/s1 |
| InChIKey | ASTBMTJDMMVVSI-PHNDWSHVSA-N |
| XLogP | 3.11 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |