C17H18N2O4 — CID 67083610
2-[(2S)-2-[carboxy(pyridin-4-ylmethyl)amino]propyl]benzoic acid (PubChem CID 67083610) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-[(2S)-2-[carboxy(pyridin-4-ylmethyl)amino]propyl]benzoic acid.
| Compound Name | 2-[(2S)-2-[carboxy(pyridin-4-ylmethyl)amino]propyl]benzoic acid |
|---|---|
| PubChem CID | 67083610 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-[(2S)-2-[carboxy(pyridin-4-ylmethyl)amino]propyl]benzoic acid |
| SMILES | C[C@@H](Cc1ccccc1C(=O)O)N(Cc1ccncc1)C(=O)O |
| InChI | InChI=1S/C17H18N2O4/c1-12(10-14-4-2-3-5-15(14)16(20)21)19(17(22)23)11-13-6-8-18-9-7-13/h2-9,12H,10-11H2,1H3,(H,20,21)(H,22,23)/t12-/m0/s1 |
| InChIKey | FGYDJRWTMZNPGB-LBPRGKRZSA-N |
| XLogP | 2.89 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |