C17H12Cl2N2O2S — CID 67083645
4-[[2-(2,6-dichloro-3-methylanilino)phenyl]methylidene]-1,3-thiazolidine-2,5-dione (PubChem CID 67083645) has the molecular formula C17H12Cl2N2O2S and a molecular weight of 379.27 g/mol. Its IUPAC name is 4-[[2-(2,6-dichloro-3-methylanilino)phenyl]methylidene]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[2-(2,6-dichloro-3-methylanilino)phenyl]methylidene]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67083645 |
| Molecular Formula | C17H12Cl2N2O2S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 4-[[2-(2,6-dichloro-3-methylanilino)phenyl]methylidene]-1,3-thiazolidine-2,5-dione |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2C=C2NC(=O)SC2=O)c1Cl |
| InChI | InChI=1S/C17H12Cl2N2O2S/c1-9-6-7-11(18)15(14(9)19)20-12-5-3-2-4-10(12)8-13-16(22)24-17(23)21-13/h2-8,20H,1H3,(H,21,23) |
| InChIKey | DHJQTXYWGLAKSU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|