C23H28O10 — CID 67083781
cyclohexa-2,5-diene-1,4-dione;2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 67083781) has the molecular formula C23H28O10 and a molecular weight of 464.47 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 67083781 |
| Molecular Formula | C23H28O10 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)C1CC=C(C)C(=O)C1.COC(=O)CC(O)(CC(=O)O)C(=O)O.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C10H14O.C7H10O7.C6H4O2/c1-7(2)9-5-4-8(3)10(11)6-9;1-14-5(10)3-7(13,6(11)12)2-4(8)9;7-5-1-2-6(8)4-3-5/h4,9H,1,5-6H2,2-3H3;13H,2-3H2,1H3,(H,8,9)(H,11,12);1-4H |
| InChIKey | PHEOSGJNXORSFM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|