C11H8N2O — CID 67084015
8H-pyrrolo[2,1-g][1,7]naphthyridin-7-one (PubChem CID 67084015) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is 8H-pyrrolo[2,1-g][1,7]naphthyridin-7-one.
| Compound Name | 8H-pyrrolo[2,1-g][1,7]naphthyridin-7-one |
|---|---|
| PubChem CID | 67084015 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 8H-pyrrolo[2,1-g][1,7]naphthyridin-7-one |
| SMILES | O=C1C=C2C=c3cccnc3=CN2C1 |
| InChI | InChI=1S/C11H8N2O/c14-10-5-9-4-8-2-1-3-12-11(8)7-13(9)6-10/h1-5,7H,6H2 |
| InChIKey | APDZWFMJLGICCG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |