C14H16F3NO4 — CID 67084032
methyl [5-[4-(trifluoromethoxy)phenyl]piperidin-3-yl] carbonate (PubChem CID 67084032) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is methyl [5-[4-(trifluoromethoxy)phenyl]piperidin-3-yl] carbonate.
| Compound Name | methyl [5-[4-(trifluoromethoxy)phenyl]piperidin-3-yl] carbonate |
|---|---|
| PubChem CID | 67084032 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl [5-[4-(trifluoromethoxy)phenyl]piperidin-3-yl] carbonate |
| SMILES | COC(=O)OC1CNCC(c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H16F3NO4/c1-20-13(19)21-12-6-10(7-18-8-12)9-2-4-11(5-3-9)22-14(15,16)17/h2-5,10,12,18H,6-8H2,1H3 |
| InChIKey | CEYFPNRJGVKCQJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |