C21H34O2 — CID 67084512
4-[(8Z,11Z)-heptadeca-8,11-dienyl]-2H-furan-5-one (PubChem CID 67084512) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 4-[(8Z,11Z)-heptadeca-8,11-dienyl]-2H-furan-5-one.
| Compound Name | 4-[(8Z,11Z)-heptadeca-8,11-dienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 67084512 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 4-[(8Z,11Z)-heptadeca-8,11-dienyl]-2H-furan-5-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC1=CCOC1=O |
| InChI | InChI=1S/C21H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18-19-23-21(20)22/h6-7,9-10,18H,2-5,8,11-17,19H2,1H3/b7-6-,10-9- |
| InChIKey | IDIKWNZCTGYJTJ-HZJYTTRNSA-N |
| XLogP | 6.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|