About ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate
ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate (PubChem CID 67084590) has the molecular formula C18H22F2O4S
and a molecular weight of 372.43 g/mol. Its IUPAC name is ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate |
| PubChem CID | 67084590 |
| Molecular Formula | C18H22F2O4S |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2ccc(S(C)(=O)=O)cc2)C(C2CCCC2)C1(F)F |
| InChI | InChI=1S/C18H22F2O4S/c1-3-24-16(21)17(13-8-10-14(11-9-13)25(2,22)23)15(18(17,19)20)12-6-4-5-7-12/h8-12,15H,3-7H2,1-2H3 |
| InChIKey | CWJWFKQKQWGXHD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate?
The IUPAC name of ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate (CID 67084590) is ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate is CCOC(=O)C1(c2ccc(S(C)(=O)=O)cc2)C(C2CCCC2)C1(F)F.
What is the InChIKey of ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate?
The InChIKey is CWJWFKQKQWGXHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2O4S/c1-3-24-16(21)17(13-8-10-14(11-9-13)25(2,22)23)15(18(17,19)20)12-6-4-5-7-12/h8-12,15H,3-7H2,1-2H3.
What are the key properties of ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate?
ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate has a molecular weight of 372.43 g/mol, XLogP of 3.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-cyclopentyl-2,2-difluoro-1-(4-methylsulfonylphenyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 67084590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).