C16H19N3O3 — CID 67084985
2-methylpropyl 4-(3-cyanophenyl)-3-oxopiperazine-1-carboxylate (PubChem CID 67084985) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-methylpropyl 4-(3-cyanophenyl)-3-oxopiperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-(3-cyanophenyl)-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 67084985 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-methylpropyl 4-(3-cyanophenyl)-3-oxopiperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(c2cccc(C#N)c2)C(=O)C1 |
| InChI | InChI=1S/C16H19N3O3/c1-12(2)11-22-16(21)18-6-7-19(15(20)10-18)14-5-3-4-13(8-14)9-17/h3-5,8,12H,6-7,10-11H2,1-2H3 |
| InChIKey | VLLFHEPGVUEHFB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |