C13H8ClF3N2O3 — CID 67085065
3-chloro-6-(2,5-dihydrofuran-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid (PubChem CID 67085065) has the molecular formula C13H8ClF3N2O3 and a molecular weight of 332.67 g/mol. Its IUPAC name is 3-chloro-6-(2,5-dihydrofuran-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid.
| Compound Name | 3-chloro-6-(2,5-dihydrofuran-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 67085065 |
| Molecular Formula | C13H8ClF3N2O3 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3-chloro-6-(2,5-dihydrofuran-2-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc2c(C(F)(F)F)cc(C3C=CCO3)cn2c1Cl |
| InChI | InChI=1S/C13H8ClF3N2O3/c14-10-9(12(20)21)18-11-7(13(15,16)17)4-6(5-19(10)11)8-2-1-3-22-8/h1-2,4-5,8H,3H2,(H,20,21) |
| InChIKey | MWDPQFUSDCXGGC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|