1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid

C9H15F3N2O3 — CID 67085125

IUPAC1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid
SMILESCCCN1CCNCC1=O.O=C(O)C(F)(F)F
InChIInChI=1S/C7H14N2O.C2HF3O2/c1-2-4-9-5-3-8-6-7(9)10;3-2(4,5)1(6)7/h8H,2-6H2,1H3;(H,6,7)
InChIKeyFUDVMWWVGIJMLX-UHFFFAOYSA-N
MW256.22 g/mol
LogP0.46
Rot. Bonds2

About 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid

1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 67085125) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid
PubChem CID67085125
Molecular FormulaC9H15F3N2O3
Molecular Weight256.22 g/mol
Exact Mass256.10
IUPAC Name1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid
SMILESCCCN1CCNCC1=O.O=C(O)C(F)(F)F
InChIInChI=1S/C7H14N2O.C2HF3O2/c1-2-4-9-5-3-8-6-7(9)10;3-2(4,5)1(6)7/h8H,2-6H2,1H3;(H,6,7)
InChIKeyFUDVMWWVGIJMLX-UHFFFAOYSA-N
XLogP0.46
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.22
LogP ≤ 50.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid?
The IUPAC name of 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid (CID 67085125) is 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid is CCCN1CCNCC1=O.O=C(O)C(F)(F)F.
What is the InChIKey of 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid?
The InChIKey is FUDVMWWVGIJMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.C2HF3O2/c1-2-4-9-5-3-8-6-7(9)10;3-2(4,5)1(6)7/h8H,2-6H2,1H3;(H,6,7).
What are the key properties of 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid?
1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid has a molecular weight of 256.22 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylpiperazin-2-one;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 67085125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).