About 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide
2-bromo-N-(3,3-dimethylcyclobutyl)acetamide (PubChem CID 67085156) has the molecular formula C8H14BrNO
and a molecular weight of 220.11 g/mol. Its IUPAC name is 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide.
Molecular Properties
| Compound Name | 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide |
| PubChem CID | 67085156 |
| Molecular Formula | C8H14BrNO |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide |
| SMILES | CC1(C)CC(NC(=O)CBr)C1 |
| InChI | InChI=1S/C8H14BrNO/c1-8(2)3-6(4-8)10-7(11)5-9/h6H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | JWSAJZGFIUAUEQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide?
The IUPAC name of 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide (CID 67085156) is 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide.
What is the SMILES notation for 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide?
The canonical SMILES for 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide is CC1(C)CC(NC(=O)CBr)C1.
What is the InChIKey of 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide?
The InChIKey is JWSAJZGFIUAUEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BrNO/c1-8(2)3-6(4-8)10-7(11)5-9/h6H,3-5H2,1-2H3,(H,10,11).
What are the key properties of 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide?
2-bromo-N-(3,3-dimethylcyclobutyl)acetamide has a molecular weight of 220.11 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(3,3-dimethylcyclobutyl)acetamide is sourced from PubChem (CID 67085156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).