About 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride
1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride (PubChem CID 67085216) has the molecular formula C10H17ClN2O
and a molecular weight of 216.71 g/mol. Its IUPAC name is 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride |
| PubChem CID | 67085216 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride |
| SMILES | Cl.O=C1CNCCN1C1C[C@H]2C[C@@H]2C1 |
| InChI | InChI=1S/C10H16N2O.ClH/c13-10-6-11-1-2-12(10)9-4-7-3-8(7)5-9;/h7-9,11H,1-6H2;1H/t7-,8-;/m1./s1 |
| InChIKey | SJTMJFUAKZQURX-SCLLHFNJSA-N |
| XLogP | 0.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride?
The IUPAC name of 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride (CID 67085216) is 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride.
What is the SMILES notation for 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride?
The canonical SMILES for 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride is Cl.O=C1CNCCN1C1C[C@H]2C[C@@H]2C1.
What is the InChIKey of 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride?
The InChIKey is SJTMJFUAKZQURX-SCLLHFNJSA-N. The full InChI is InChI=1S/C10H16N2O.ClH/c13-10-6-11-1-2-12(10)9-4-7-3-8(7)5-9;/h7-9,11H,1-6H2;1H/t7-,8-;/m1./s1.
What are the key properties of 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride?
1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride has a molecular weight of 216.71 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,5R)-3-bicyclo[3.1.0]hexanyl]piperazin-2-one;hydrochloride is sourced from PubChem (CID 67085216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).