About sodium thiophen-3-yl sulfate
sodium thiophen-3-yl sulfate (PubChem CID 67085269) has the molecular formula C4H3NaO4S2
and a molecular weight of 202.19 g/mol. Its IUPAC name is sodium thiophen-3-yl sulfate.
Molecular Properties
| Compound Name | sodium thiophen-3-yl sulfate |
| PubChem CID | 67085269 |
| Molecular Formula | C4H3NaO4S2 |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 201.94 |
| IUPAC Name | sodium thiophen-3-yl sulfate |
| SMILES | O=S(=O)([O-])Oc1ccsc1.[Na+] |
| InChI | InChI=1S/C4H4O4S2.Na/c5-10(6,7)8-4-1-2-9-3-4;/h1-3H,(H,5,6,7);/q;+1/p-1 |
| InChIKey | FGXFBCKSXODRCZ-UHFFFAOYSA-M |
| XLogP | -2.41 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium thiophen-3-yl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium thiophen-3-yl sulfate?
The IUPAC name of sodium thiophen-3-yl sulfate (CID 67085269) is sodium thiophen-3-yl sulfate.
What is the SMILES notation for sodium thiophen-3-yl sulfate?
The canonical SMILES for sodium thiophen-3-yl sulfate is O=S(=O)([O-])Oc1ccsc1.[Na+].
What is the InChIKey of sodium thiophen-3-yl sulfate?
The InChIKey is FGXFBCKSXODRCZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H4O4S2.Na/c5-10(6,7)8-4-1-2-9-3-4;/h1-3H,(H,5,6,7);/q;+1/p-1.
What are the key properties of sodium thiophen-3-yl sulfate?
sodium thiophen-3-yl sulfate has a molecular weight of 202.19 g/mol, XLogP of -2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium thiophen-3-yl sulfate is sourced from PubChem (CID 67085269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).