About N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide
N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide (PubChem CID 67085392) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide.
Molecular Properties
| Compound Name | N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide |
| PubChem CID | 67085392 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide |
| SMILES | CC1(C)CC(NC(=O)CNCCO)C1 |
| InChI | InChI=1S/C10H20N2O2/c1-10(2)5-8(6-10)12-9(14)7-11-3-4-13/h8,11,13H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | DKBCSOPXWPNBTE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide?
The IUPAC name of N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide (CID 67085392) is N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide.
What is the SMILES notation for N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide?
The canonical SMILES for N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide is CC1(C)CC(NC(=O)CNCCO)C1.
What is the InChIKey of N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide?
The InChIKey is DKBCSOPXWPNBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-10(2)5-8(6-10)12-9(14)7-11-3-4-13/h8,11,13H,3-7H2,1-2H3,(H,12,14).
What are the key properties of N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide?
N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide has a molecular weight of 200.28 g/mol, XLogP of -0.13, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylcyclobutyl)-2-(2-hydroxyethylamino)acetamide is sourced from PubChem (CID 67085392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).