C19H21IO6 — CID 6708556
(2R,3S)-2-(3,4-dimethoxyphenyl)-8-iodo-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-ol (PubChem CID 6708556) has the molecular formula C19H21IO6 and a molecular weight of 472.28 g/mol. Its IUPAC name is (2R,3S)-2-(3,4-dimethoxyphenyl)-8-iodo-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | (2R,3S)-2-(3,4-dimethoxyphenyl)-8-iodo-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 6708556 |
| Molecular Formula | C19H21IO6 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | (2R,3S)-2-(3,4-dimethoxyphenyl)-8-iodo-5,7-dimethoxy-3,4-dihydro-2H-chromen-3-ol |
| SMILES | COc1ccc([C@H]2Oc3c(I)c(OC)cc(OC)c3C[C@@H]2O)cc1OC |
| InChI | InChI=1S/C19H21IO6/c1-22-13-6-5-10(7-15(13)24-3)18-12(21)8-11-14(23-2)9-16(25-4)17(20)19(11)26-18/h5-7,9,12,18,21H,8H2,1-4H3/t12-,18+/m0/s1 |
| InChIKey | VTUMIISWLFIURS-KPZWWZAWSA-N |
| XLogP | 3.36 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|