C16H20O — CID 6708561
(4aS,10aS)-4a,7-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one (PubChem CID 6708561) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (4aS,10aS)-4a,7-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one.
| Compound Name | (4aS,10aS)-4a,7-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one |
|---|---|
| PubChem CID | 6708561 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (4aS,10aS)-4a,7-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one |
| SMILES | Cc1ccc2c(c1)CC[C@H]1CC(=O)CC[C@]21C |
| InChI | InChI=1S/C16H20O/c1-11-3-6-15-12(9-11)4-5-13-10-14(17)7-8-16(13,15)2/h3,6,9,13H,4-5,7-8,10H2,1-2H3/t13-,16-/m0/s1 |
| InChIKey | JZECOIINDLDHBV-BBRMVZONSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |