C26H36O8 — CID 6708591
methyl (1S,7R,8S,12R,19R)-19-acetyloxy-1,8,12,16,16-pentamethyl-5,15-dioxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecane-7-carboxylate (PubChem CID 6708591) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is methyl (1S,7R,8S,12R,19R)-19-acetyloxy-1,8,12,16,16-pentamethyl-5,15-dioxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecane-7-carboxylate.
| Compound Name | methyl (1S,7R,8S,12R,19R)-19-acetyloxy-1,8,12,16,16-pentamethyl-5,15-dioxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecane-7-carboxylate |
|---|---|
| PubChem CID | 6708591 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | methyl (1S,7R,8S,12R,19R)-19-acetyloxy-1,8,12,16,16-pentamethyl-5,15-dioxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadecane-7-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(=O)C2OC23[C@@]1(C)CCC1[C@@]2(C)CCC(=O)C(C)(C)C2C[C@@H](OC(C)=O)[C@]13C |
| InChI | InChI=1S/C26H36O8/c1-13(27)32-17-12-15-22(2,3)16(28)9-10-23(15,4)14-8-11-24(5)18(20(29)31-7)33-21(30)19-26(24,34-19)25(14,17)6/h14-15,17-19H,8-12H2,1-7H3/t14?,15?,17-,18+,19?,23-,24+,25+,26?/m1/s1 |
| InChIKey | CDTMPWYDQKWYFT-IASWOTTCSA-N |
| XLogP | 2.99 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|