C15H18N4O5 — CID 67086366
2-[(10-hydroxy-5,13-dimethyl-12-oxo-1,5,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10-triene-11-carbonyl)amino]acetic acid (PubChem CID 67086366) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[(10-hydroxy-5,13-dimethyl-12-oxo-1,5,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10-triene-11-carbonyl)amino]acetic acid.
| Compound Name | 2-[(10-hydroxy-5,13-dimethyl-12-oxo-1,5,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10-triene-11-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 67086366 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[(10-hydroxy-5,13-dimethyl-12-oxo-1,5,13-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10-triene-11-carbonyl)amino]acetic acid |
| SMILES | CN1CCc2c(cc3c(O)c(C(=O)NCC(=O)O)c(=O)n(C)n23)C1 |
| InChI | InChI=1S/C15H18N4O5/c1-17-4-3-9-8(7-17)5-10-13(22)12(14(23)16-6-11(20)21)15(24)18(2)19(9)10/h5,22H,3-4,6-7H2,1-2H3,(H,16,23)(H,20,21) |
| InChIKey | ISSFRPDINSFBNL-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |