About 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile
6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile (PubChem CID 67086426) has the molecular formula C9H4FN3O
and a molecular weight of 189.15 g/mol. Its IUPAC name is 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile |
| PubChem CID | 67086426 |
| Molecular Formula | C9H4FN3O |
| Molecular Weight | 189.15 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(F)c(-c2ncco2)c1 |
| InChI | InChI=1S/C9H4FN3O/c10-8-7(9-12-1-2-14-9)3-6(4-11)5-13-8/h1-3,5H |
| InChIKey | BXUBDHXYTKSLHG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile?
The IUPAC name of 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile (CID 67086426) is 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile?
The canonical SMILES for 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile is N#Cc1cnc(F)c(-c2ncco2)c1.
What is the InChIKey of 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile?
The InChIKey is BXUBDHXYTKSLHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4FN3O/c10-8-7(9-12-1-2-14-9)3-6(4-11)5-13-8/h1-3,5H.
What are the key properties of 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile?
6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile has a molecular weight of 189.15 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-5-(1,3-oxazol-2-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 67086426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).