C22H32N8O8 — CID 67086660
4-[(2S)-2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione (PubChem CID 67086660) has the molecular formula C22H32N8O8 and a molecular weight of 536.55 g/mol. Its IUPAC name is 4-[(2S)-2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione.
| Compound Name | 4-[(2S)-2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 67086660 |
| Molecular Formula | C22H32N8O8 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 4-[(2S)-2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione |
| SMILES | C[C@@H](CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1.C[C@@H](CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/2C11H16N4O4/c2*1-7(15-5-10(18)13-11(19)6-15)2-14-3-8(16)12-9(17)4-14/h2*7H,2-6H2,1H3,(H,12,16,17)(H,13,18,19)/t2*7-/m00/s1 |
| InChIKey | PKLDMKNHGIIQLE-VGMFFHCQSA-N |
| XLogP | -5.42 |
| TPSA | 197.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|