2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid

C10H12O4 — CID 67086722

IUPAC2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid
SMILESCC1(C)OC2C=CC=C(C(=O)O)C2O1
InChIInChI=1S/C10H12O4/c1-10(2)13-7-5-3-4-6(9(11)12)8(7)14-10/h3-5,7-8H,1-2H3,(H,11,12)
InChIKeyDGTFQQCUIFTNHP-UHFFFAOYSA-N
MW196.20 g/mol
LogP1.09
Rot. Bonds1

About 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid

2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid (PubChem CID 67086722) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid.

Molecular Properties

Compound Name2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid
PubChem CID67086722
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid
SMILESCC1(C)OC2C=CC=C(C(=O)O)C2O1
InChIInChI=1S/C10H12O4/c1-10(2)13-7-5-3-4-6(9(11)12)8(7)14-10/h3-5,7-8H,1-2H3,(H,11,12)
InChIKeyDGTFQQCUIFTNHP-UHFFFAOYSA-N
XLogP1.09
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 51.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid?
The IUPAC name of 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid (CID 67086722) is 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid.
What is the SMILES notation for 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid?
The canonical SMILES for 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid is CC1(C)OC2C=CC=C(C(=O)O)C2O1.
What is the InChIKey of 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid?
The InChIKey is DGTFQQCUIFTNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-10(2)13-7-5-3-4-6(9(11)12)8(7)14-10/h3-5,7-8H,1-2H3,(H,11,12).
What are the key properties of 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid?
2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid has a molecular weight of 196.20 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole-4-carboxylic acid is sourced from PubChem (CID 67086722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).