C28H31N3O — CID 67087168
4-[[4-benzyl-1-(3-propan-2-ylphenyl)piperazin-2-yl]methoxy]benzonitrile (PubChem CID 67087168) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is 4-[[4-benzyl-1-(3-propan-2-ylphenyl)piperazin-2-yl]methoxy]benzonitrile.
| Compound Name | 4-[[4-benzyl-1-(3-propan-2-ylphenyl)piperazin-2-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 67087168 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 4-[[4-benzyl-1-(3-propan-2-ylphenyl)piperazin-2-yl]methoxy]benzonitrile |
| SMILES | CC(C)c1cccc(N2CCN(Cc3ccccc3)CC2COc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C28H31N3O/c1-22(2)25-9-6-10-26(17-25)31-16-15-30(19-24-7-4-3-5-8-24)20-27(31)21-32-28-13-11-23(18-29)12-14-28/h3-14,17,22,27H,15-16,19-21H2,1-2H3 |
| InChIKey | BJITWDSINAVUHY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |