C34H38N2O3 — CID 67087173
(3S)-3-[4-[[4-[(1,5-dimethylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 67087173) has the molecular formula C34H38N2O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is (3S)-3-[4-[[4-[(1,5-dimethylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[4-[(1,5-dimethylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 67087173 |
| Molecular Formula | C34H38N2O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | (3S)-3-[4-[[4-[(1,5-dimethylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc(CN3CCC4(CC3)CN(C)c3ccc(C)cc34)cc2)cc1 |
| InChI | InChI=1S/C34H38N2O3/c1-4-5-29(21-33(37)38)28-11-13-30(14-12-28)39-23-27-9-7-26(8-10-27)22-36-18-16-34(17-19-36)24-35(3)32-15-6-25(2)20-31(32)34/h6-15,20,29H,16-19,21-24H2,1-3H3,(H,37,38)/t29-/m0/s1 |
| InChIKey | LCBHFUFPPJJGPP-LJAQVGFWSA-N |
| XLogP | 6.14 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|