C27H32O6 — CID 6708754
methyl 2-[(1R,5R,6R,13S,16S)-6-(furan-3-yl)-1,5,15,15-tetramethyl-14,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-8,10-dien-16-yl]acetate (PubChem CID 6708754) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is methyl 2-[(1R,5R,6R,13S,16S)-6-(furan-3-yl)-1,5,15,15-tetramethyl-14,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-8,10-dien-16-yl]acetate.
| Compound Name | methyl 2-[(1R,5R,6R,13S,16S)-6-(furan-3-yl)-1,5,15,15-tetramethyl-14,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-8,10-dien-16-yl]acetate |
|---|---|
| PubChem CID | 6708754 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | methyl 2-[(1R,5R,6R,13S,16S)-6-(furan-3-yl)-1,5,15,15-tetramethyl-14,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadeca-8,10-dien-16-yl]acetate |
| SMILES | COC(=O)C[C@H]1C(C)(C)C(=O)[C@@H]2CC3=C4C=CO[C@@H](c5ccoc5)[C@]4(C)CCC3[C@@]1(C)C2=O |
| InChI | InChI=1S/C27H32O6/c1-25(2)20(13-21(28)31-5)27(4)19-6-9-26(3)18(16(19)12-17(22(25)29)23(27)30)8-11-33-24(26)15-7-10-32-14-15/h7-8,10-11,14,17,19-20,24H,6,9,12-13H2,1-5H3/t17-,19?,20-,24-,26+,27+/m0/s1 |
| InChIKey | JIMBTOKMNHFRCN-ZLZONFQWSA-N |
| XLogP | 4.96 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|