C15H20O — CID 6708760
(2R,4aS,10aR)-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-2-ol (PubChem CID 6708760) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (2R,4aS,10aR)-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-2-ol.
| Compound Name | (2R,4aS,10aR)-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-2-ol |
|---|---|
| PubChem CID | 6708760 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2R,4aS,10aR)-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-2-ol |
| SMILES | C[C@]12CC[C@@H](O)C[C@H]1CCc1ccccc12 |
| InChI | InChI=1S/C15H20O/c1-15-9-8-13(16)10-12(15)7-6-11-4-2-3-5-14(11)15/h2-5,12-13,16H,6-10H2,1H3/t12-,13-,15+/m1/s1 |
| InChIKey | MVNJNWNFUCRWBW-NFAWXSAZSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |