C27H33Cl2N3O4Si — CID 67088187
(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[5-[2-(2,3-dichlorophenyl)propanoylamino]-1-oxoisoquinolin-2-yl]propanamide (PubChem CID 67088187) has the molecular formula C27H33Cl2N3O4Si and a molecular weight of 562.57 g/mol. Its IUPAC name is (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[5-[2-(2,3-dichlorophenyl)propanoylamino]-1-oxoisoquinolin-2-yl]propanamide.
| Compound Name | (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[5-[2-(2,3-dichlorophenyl)propanoylamino]-1-oxoisoquinolin-2-yl]propanamide |
|---|---|
| PubChem CID | 67088187 |
| Molecular Formula | C27H33Cl2N3O4Si |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[5-[2-(2,3-dichlorophenyl)propanoylamino]-1-oxoisoquinolin-2-yl]propanamide |
| SMILES | CC(C(=O)Nc1cccc2c(=O)n([C@H](CO[Si](C)(C)C(C)(C)C)C(N)=O)ccc12)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C27H33Cl2N3O4Si/c1-16(17-9-7-11-20(28)23(17)29)25(34)31-21-12-8-10-19-18(21)13-14-32(26(19)35)22(24(30)33)15-36-37(5,6)27(2,3)4/h7-14,16,22H,15H2,1-6H3,(H2,30,33)(H,31,34)/t16?,22-/m1/s1 |
| InChIKey | VYCCUTBJHFYCPO-VXNXSFHZSA-N |
| XLogP | 6.10 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|