About N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine
N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine (PubChem CID 67088839) has the molecular formula C10H13N5O2
and a molecular weight of 235.25 g/mol. Its IUPAC name is N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine |
| PubChem CID | 67088839 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine |
| SMILES | CCN(CC)c1n[nH]c2ncc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C10H13N5O2/c1-3-14(4-2)10-8-5-7(15(16)17)6-11-9(8)12-13-10/h5-6H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | YKLYQRAYJYJSDU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine?
The IUPAC name of N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine (CID 67088839) is N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine.
What is the SMILES notation for N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine?
The canonical SMILES for N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine is CCN(CC)c1n[nH]c2ncc([N+](=O)[O-])cc12.
What is the InChIKey of N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine?
The InChIKey is YKLYQRAYJYJSDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O2/c1-3-14(4-2)10-8-5-7(15(16)17)6-11-9(8)12-13-10/h5-6H,3-4H2,1-2H3,(H,11,12,13).
What are the key properties of N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine?
N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine has a molecular weight of 235.25 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine is sourced from PubChem (CID 67088839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).