C19H18F3N3O2 — CID 67088861
3,4-dimethyl-1-[[6-(4-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-2,5-dione (PubChem CID 67088861) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 3,4-dimethyl-1-[[6-(4-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-2,5-dione.
| Compound Name | 3,4-dimethyl-1-[[6-(4-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67088861 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3,4-dimethyl-1-[[6-(4-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(-c2nc(NN3C(=O)C(C)C(C)C3=O)ccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N3O2/c1-10-4-6-13(7-5-10)16-14(19(20,21)22)8-9-15(23-16)24-25-17(26)11(2)12(3)18(25)27/h4-9,11-12H,1-3H3,(H,23,24) |
| InChIKey | MBZGSPGWLPJPHY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|