C24H15F5N3O5S- — CID 67089022
5-(2-carboxyethyl)-3-[2,6-difluoro-3-[N-sulfinato-4-(trifluoromethyl)anilino]benzoyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 67089022) has the molecular formula C24H15F5N3O5S- and a molecular weight of 552.46 g/mol. Its IUPAC name is 5-(2-carboxyethyl)-3-[2,6-difluoro-3-[N-sulfinato-4-(trifluoromethyl)anilino]benzoyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(2-carboxyethyl)-3-[2,6-difluoro-3-[N-sulfinato-4-(trifluoromethyl)anilino]benzoyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 67089022 |
| Molecular Formula | C24H15F5N3O5S- |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | 5-(2-carboxyethyl)-3-[2,6-difluoro-3-[N-sulfinato-4-(trifluoromethyl)anilino]benzoyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=C(O)CCc1cnc2[nH]cc(C(=O)c3c(F)ccc(N(c4ccc(C(F)(F)F)cc4)S(=O)[O-])c3F)c2c1 |
| InChI | InChI=1S/C24H16F5N3O5S/c25-17-6-7-18(32(38(36)37)14-4-2-13(3-5-14)24(27,28)29)21(26)20(17)22(35)16-11-31-23-15(16)9-12(10-30-23)1-8-19(33)34/h2-7,9-11H,1,8H2,(H,30,31)(H,33,34)(H,36,37)/p-1 |
| InChIKey | GAFKGOBEEJDPMI-UHFFFAOYSA-M |
| XLogP | 5.04 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|