C27H28FNO5 — CID 67089076
(1S,2S)-1-[(4-fluorophenyl)methyl]-N-[(2-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine;oxalic acid (PubChem CID 67089076) has the molecular formula C27H28FNO5 and a molecular weight of 465.52 g/mol. Its IUPAC name is (1S,2S)-1-[(4-fluorophenyl)methyl]-N-[(2-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine;oxalic acid.
| Compound Name | (1S,2S)-1-[(4-fluorophenyl)methyl]-N-[(2-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine;oxalic acid |
|---|---|
| PubChem CID | 67089076 |
| Molecular Formula | C27H28FNO5 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | (1S,2S)-1-[(4-fluorophenyl)methyl]-N-[(2-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine;oxalic acid |
| SMILES | COc1ccccc1CN[C@H]1CCc2ccccc2[C@@H]1Cc1ccc(F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H26FNO.C2H2O4/c1-28-25-9-5-3-7-20(25)17-27-24-15-12-19-6-2-4-8-22(19)23(24)16-18-10-13-21(26)14-11-18;3-1(4)2(5)6/h2-11,13-14,23-24,27H,12,15-17H2,1H3;(H,3,4)(H,5,6)/t23-,24-;/m0./s1 |
| InChIKey | FZFTYYMJMNUVQX-UKOKCHKQSA-N |
| XLogP | 4.42 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|