C22H36F3NO3Si — CID 67089234
tert-butyl-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]butan-2-yl]carbamic acid (PubChem CID 67089234) has the molecular formula C22H36F3NO3Si and a molecular weight of 447.61 g/mol. Its IUPAC name is tert-butyl-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]butan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67089234 |
| Molecular Formula | C22H36F3NO3Si |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | tert-butyl-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]butan-2-yl]carbamic acid |
| SMILES | C[C@@H](c1ccc(C(F)(F)F)cc1)[C@@H](CO[Si](C)(C)C(C)(C)C)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C22H36F3NO3Si/c1-15(16-10-12-17(13-11-16)22(23,24)25)18(26(19(27)28)20(2,3)4)14-29-30(8,9)21(5,6)7/h10-13,15,18H,14H2,1-9H3,(H,27,28)/t15-,18+/m0/s1 |
| InChIKey | KXPZTCJSQUNKCP-MAUKXSAKSA-N |
| XLogP | 6.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|