About 6-prop-2-enylthieno[3,2-b]thiophene
6-prop-2-enylthieno[3,2-b]thiophene (PubChem CID 67089338) has the molecular formula C9H8S2
and a molecular weight of 180.30 g/mol. Its IUPAC name is 6-prop-2-enylthieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 6-prop-2-enylthieno[3,2-b]thiophene |
| PubChem CID | 67089338 |
| Molecular Formula | C9H8S2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 6-prop-2-enylthieno[3,2-b]thiophene |
| SMILES | C=CCc1csc2ccsc12 |
| InChI | InChI=1S/C9H8S2/c1-2-3-7-6-11-8-4-5-10-9(7)8/h2,4-6H,1,3H2 |
| InChIKey | DZXMBBCHEMTKSE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-enylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-enylthieno[3,2-b]thiophene?
The IUPAC name of 6-prop-2-enylthieno[3,2-b]thiophene (CID 67089338) is 6-prop-2-enylthieno[3,2-b]thiophene.
What is the SMILES notation for 6-prop-2-enylthieno[3,2-b]thiophene?
The canonical SMILES for 6-prop-2-enylthieno[3,2-b]thiophene is C=CCc1csc2ccsc12.
What is the InChIKey of 6-prop-2-enylthieno[3,2-b]thiophene?
The InChIKey is DZXMBBCHEMTKSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8S2/c1-2-3-7-6-11-8-4-5-10-9(7)8/h2,4-6H,1,3H2.
What are the key properties of 6-prop-2-enylthieno[3,2-b]thiophene?
6-prop-2-enylthieno[3,2-b]thiophene has a molecular weight of 180.30 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-enylthieno[3,2-b]thiophene is sourced from PubChem (CID 67089338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).