C24H38F3NO3Si — CID 67089459
tert-butyl-[(E,2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]hex-4-en-2-yl]carbamic acid (PubChem CID 67089459) has the molecular formula C24H38F3NO3Si and a molecular weight of 473.65 g/mol. Its IUPAC name is tert-butyl-[(E,2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]hex-4-en-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(E,2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]hex-4-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67089459 |
| Molecular Formula | C24H38F3NO3Si |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | tert-butyl-[(E,2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]hex-4-en-2-yl]carbamic acid |
| SMILES | C/C=C/[C@@H](c1ccc(C(F)(F)F)cc1)[C@@H](CO[Si](C)(C)C(C)(C)C)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C24H38F3NO3Si/c1-10-11-19(17-12-14-18(15-13-17)24(25,26)27)20(28(21(29)30)22(2,3)4)16-31-32(8,9)23(5,6)7/h10-15,19-20H,16H2,1-9H3,(H,29,30)/b11-10+/t19-,20+/m0/s1 |
| InChIKey | DNSLGARHDDKTTH-RRCSEMEMSA-N |
| XLogP | 7.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|