C18H21BrN4O2 — CID 67090176
[(2S)-2-[[(5-bromopyrimidin-2-yl)amino]methyl]piperidin-1-yl]-(2-methoxyphenyl)methanone (PubChem CID 67090176) has the molecular formula C18H21BrN4O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is [(2S)-2-[[(5-bromopyrimidin-2-yl)amino]methyl]piperidin-1-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [(2S)-2-[[(5-bromopyrimidin-2-yl)amino]methyl]piperidin-1-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 67090176 |
| Molecular Formula | C18H21BrN4O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [(2S)-2-[[(5-bromopyrimidin-2-yl)amino]methyl]piperidin-1-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)N1CCCC[C@H]1CNc1ncc(Br)cn1 |
| InChI | InChI=1S/C18H21BrN4O2/c1-25-16-8-3-2-7-15(16)17(24)23-9-5-4-6-14(23)12-22-18-20-10-13(19)11-21-18/h2-3,7-8,10-11,14H,4-6,9,12H2,1H3,(H,20,21,22)/t14-/m0/s1 |
| InChIKey | OWHHPZDIVRVWGK-AWEZNQCLSA-N |
| XLogP | 3.35 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |