C30H26ClF3N4O2 — CID 67091848
3-[1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl]-N-(2-phenoxyethyl)benzamide (PubChem CID 67091848) has the molecular formula C30H26ClF3N4O2 and a molecular weight of 567.01 g/mol. Its IUPAC name is 3-[1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl]-N-(2-phenoxyethyl)benzamide.
| Compound Name | 3-[1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl]-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 67091848 |
| Molecular Formula | C30H26ClF3N4O2 |
| Molecular Weight | 567.01 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 3-[1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl]-N-(2-phenoxyethyl)benzamide |
| SMILES | O=C(NCCOc1ccccc1)c1cccc(-c2cnc3c(c2)N(Cc2cc(Cl)ccc2C(F)(F)F)CCN3)c1 |
| InChI | InChI=1S/C30H26ClF3N4O2/c31-24-9-10-26(30(32,33)34)23(16-24)19-38-13-11-35-28-27(38)17-22(18-37-28)20-5-4-6-21(15-20)29(39)36-12-14-40-25-7-2-1-3-8-25/h1-10,15-18H,11-14,19H2,(H,35,37)(H,36,39) |
| InChIKey | NBTMNGZSFUUEIB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.01 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|