C20H22N6S — CID 67091973
N'-[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]-N-[(2S)-2-phenylpropyl]methanediamine (PubChem CID 67091973) has the molecular formula C20H22N6S and a molecular weight of 378.51 g/mol. Its IUPAC name is N'-[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]-N-[(2S)-2-phenylpropyl]methanediamine.
| Compound Name | N'-[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]-N-[(2S)-2-phenylpropyl]methanediamine |
|---|---|
| PubChem CID | 67091973 |
| Molecular Formula | C20H22N6S |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N'-[5-(3-methyl-2H-indazol-5-yl)-1,3,4-thiadiazol-2-yl]-N-[(2S)-2-phenylpropyl]methanediamine |
| SMILES | Cc1[nH]nc2ccc(-c3nnc(NCNC[C@@H](C)c4ccccc4)s3)cc12 |
| InChI | InChI=1S/C20H22N6S/c1-13(15-6-4-3-5-7-15)11-21-12-22-20-26-25-19(27-20)16-8-9-18-17(10-16)14(2)23-24-18/h3-10,13,21H,11-12H2,1-2H3,(H,22,26)(H,23,24)/t13-/m1/s1 |
| InChIKey | YVOPKZZSPJIYEL-CYBMUJFWSA-N |
| XLogP | 4.15 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|