C20H24N6OS — CID 67092329
4-N-[(4,5-dimethylthiophen-2-yl)methylideneamino]-2-N-(2-methoxyethyl)-2-N-methyl-6-pyridin-4-ylpyrimidine-2,4-diamine (PubChem CID 67092329) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-N-[(4,5-dimethylthiophen-2-yl)methylideneamino]-2-N-(2-methoxyethyl)-2-N-methyl-6-pyridin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(4,5-dimethylthiophen-2-yl)methylideneamino]-2-N-(2-methoxyethyl)-2-N-methyl-6-pyridin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67092329 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-N-[(4,5-dimethylthiophen-2-yl)methylideneamino]-2-N-(2-methoxyethyl)-2-N-methyl-6-pyridin-4-ylpyrimidine-2,4-diamine |
| SMILES | COCCN(C)c1nc(NN=Cc2cc(C)c(C)s2)cc(-c2ccncc2)n1 |
| InChI | InChI=1S/C20H24N6OS/c1-14-11-17(28-15(14)2)13-22-25-19-12-18(16-5-7-21-8-6-16)23-20(24-19)26(3)9-10-27-4/h5-8,11-13H,9-10H2,1-4H3,(H,23,24,25) |
| InChIKey | SWZFIMWAQGDPLY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|