C16H30O3Si — CID 67092924
(3aS,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-2,3,3a,4,6,7-hexahydroinden-5-ol (PubChem CID 67092924) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (3aS,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-2,3,3a,4,6,7-hexahydroinden-5-ol.
| Compound Name | (3aS,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-2,3,3a,4,6,7-hexahydroinden-5-ol |
|---|---|
| PubChem CID | 67092924 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (3aS,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-2,3,3a,4,6,7-hexahydroinden-5-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@](O)(CO)C[C@@H]2CCC=C21 |
| InChI | InChI=1S/C16H30O3Si/c1-15(2,3)20(4,5)19-14-10-16(18,11-17)9-12-7-6-8-13(12)14/h8,12,14,17-18H,6-7,9-11H2,1-5H3/t12-,14+,16-/m0/s1 |
| InChIKey | IFZXLAOIAVGJTN-BJJXKVORSA-N |
| XLogP | 3.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|