About (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole
(2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole (PubChem CID 67092969) has the molecular formula C9H16N2O4
and a molecular weight of 216.24 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole |
| PubChem CID | 67092969 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole |
| SMILES | C1=CCNC1.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C4H7N/c6-3(5(9)10)1-2-4(7)8;1-2-4-5-3-1/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2,5H,3-4H2/t3-;/m0./s1 |
| InChIKey | PVADRZXUGCTKJX-DFWYDOINSA-N |
| XLogP | -0.59 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole?
The IUPAC name of (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole (CID 67092969) is (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole.
What is the SMILES notation for (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole?
The canonical SMILES for (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole is C1=CCNC1.N[C@@H](CCC(=O)O)C(=O)O.
What is the InChIKey of (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole?
The InChIKey is PVADRZXUGCTKJX-DFWYDOINSA-N. The full InChI is InChI=1S/C5H9NO4.C4H7N/c6-3(5(9)10)1-2-4(7)8;1-2-4-5-3-1/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2,5H,3-4H2/t3-;/m0./s1.
What are the key properties of (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole?
(2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole has a molecular weight of 216.24 g/mol, XLogP of -0.59, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanedioic acid;2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 67092969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).