About tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate
tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 67092985) has the molecular formula C12H19F2NO2
and a molecular weight of 247.28 g/mol. Its IUPAC name is tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate |
| PubChem CID | 67092985 |
| Molecular Formula | C12H19F2NO2 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC2)C(F)(F)C1 |
| InChI | InChI=1S/C12H19F2NO2/c1-10(2,3)17-9(16)15-7-6-11(4-5-11)12(13,14)8-15/h4-8H2,1-3H3 |
| InChIKey | IWTFEXJMRWLOGA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate?
The IUPAC name of tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate (CID 67092985) is tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate.
What is the SMILES notation for tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate?
The canonical SMILES for tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate is CC(C)(C)OC(=O)N1CCC2(CC2)C(F)(F)C1.
What is the InChIKey of tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate?
The InChIKey is IWTFEXJMRWLOGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2NO2/c1-10(2,3)17-9(16)15-7-6-11(4-5-11)12(13,14)8-15/h4-8H2,1-3H3.
What are the key properties of tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate?
tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate has a molecular weight of 247.28 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 8,8-difluoro-6-azaspiro[2.5]octane-6-carboxylate is sourced from PubChem (CID 67092985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).