C17H27N3O4 — CID 67093366
(3S,6S,8aS)-3-[3-(8-hydroxy-6-azaspiro[2.5]octan-6-yl)-3-oxopropyl]-6-methyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyrazin-5-one (PubChem CID 67093366) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is (3S,6S,8aS)-3-[3-(8-hydroxy-6-azaspiro[2.5]octan-6-yl)-3-oxopropyl]-6-methyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyrazin-5-one.
| Compound Name | (3S,6S,8aS)-3-[3-(8-hydroxy-6-azaspiro[2.5]octan-6-yl)-3-oxopropyl]-6-methyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyrazin-5-one |
|---|---|
| PubChem CID | 67093366 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (3S,6S,8aS)-3-[3-(8-hydroxy-6-azaspiro[2.5]octan-6-yl)-3-oxopropyl]-6-methyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyrazin-5-one |
| SMILES | C[C@@H]1NC[C@@H]2OC[C@H](CCC(=O)N3CCC4(CC4)C(O)C3)N2C1=O |
| InChI | InChI=1S/C17H27N3O4/c1-11-16(23)20-12(10-24-15(20)8-18-11)2-3-14(22)19-7-6-17(4-5-17)13(21)9-19/h11-13,15,18,21H,2-10H2,1H3/t11-,12-,13?,15-/m0/s1 |
| InChIKey | KDCSFPRHBRIVPE-VKXBSSMUSA-N |
| XLogP | -0.31 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |