C23H26ClN5O2S — CID 67093827
2-chloro-N-[[4-[[2-(3,5-dimethylanilino)-5-methylpyrimidin-4-yl]amino]phenyl]methyl]cyclopropane-1-sulfonamide (PubChem CID 67093827) has the molecular formula C23H26ClN5O2S and a molecular weight of 472.01 g/mol. Its IUPAC name is 2-chloro-N-[[4-[[2-(3,5-dimethylanilino)-5-methylpyrimidin-4-yl]amino]phenyl]methyl]cyclopropane-1-sulfonamide.
| Compound Name | 2-chloro-N-[[4-[[2-(3,5-dimethylanilino)-5-methylpyrimidin-4-yl]amino]phenyl]methyl]cyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 67093827 |
| Molecular Formula | C23H26ClN5O2S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-chloro-N-[[4-[[2-(3,5-dimethylanilino)-5-methylpyrimidin-4-yl]amino]phenyl]methyl]cyclopropane-1-sulfonamide |
| SMILES | Cc1cc(C)cc(Nc2ncc(C)c(Nc3ccc(CNS(=O)(=O)C4CC4Cl)cc3)n2)c1 |
| InChI | InChI=1S/C23H26ClN5O2S/c1-14-8-15(2)10-19(9-14)28-23-25-12-16(3)22(29-23)27-18-6-4-17(5-7-18)13-26-32(30,31)21-11-20(21)24/h4-10,12,20-21,26H,11,13H2,1-3H3,(H2,25,27,28,29) |
| InChIKey | PEFHSKPUHYMFED-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|