C28H45NO8 — CID 6709405
[(2R,3R)-1-[(4R)-5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]-17-hydroxy-2-methyl-1,4,7-trioxoheptadec-5-en-3-yl] acetate (PubChem CID 6709405) has the molecular formula C28H45NO8 and a molecular weight of 523.67 g/mol. Its IUPAC name is [(2R,3R)-1-[(4R)-5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]-17-hydroxy-2-methyl-1,4,7-trioxoheptadec-5-en-3-yl] acetate.
| Compound Name | [(2R,3R)-1-[(4R)-5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]-17-hydroxy-2-methyl-1,4,7-trioxoheptadec-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 6709405 |
| Molecular Formula | C28H45NO8 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | [(2R,3R)-1-[(4R)-5,5-dimethyl-2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl]-17-hydroxy-2-methyl-1,4,7-trioxoheptadec-5-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](C(=O)C=CC(=O)CCCCCCCCCCO)[C@@H](C)C(=O)N1C(=O)OC(C)(C)[C@H]1C(C)C |
| InChI | InChI=1S/C28H45NO8/c1-19(2)25-28(5,6)37-27(35)29(25)26(34)20(3)24(36-21(4)31)23(33)17-16-22(32)15-13-11-9-7-8-10-12-14-18-30/h16-17,19-20,24-25,30H,7-15,18H2,1-6H3/t20-,24-,25-/m1/s1 |
| InChIKey | USKRHRFYPLHRGL-NIJXNBFTSA-N |
| XLogP | 4.53 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|