About 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline
4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline (PubChem CID 67094230) has the molecular formula C18H17FN2O2
and a molecular weight of 312.34 g/mol. Its IUPAC name is 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline |
| PubChem CID | 67094230 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cnc(-c3ccc(OCF)cc3)o2)cc1 |
| InChI | InChI=1S/C18H17FN2O2/c1-21(2)15-7-3-13(4-8-15)17-11-20-18(23-17)14-5-9-16(10-6-14)22-12-19/h3-11H,12H2,1-2H3 |
| InChIKey | SOZVRBXNCUTMHV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline?
The IUPAC name of 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline (CID 67094230) is 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline?
The canonical SMILES for 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline is CN(C)c1ccc(-c2cnc(-c3ccc(OCF)cc3)o2)cc1.
What is the InChIKey of 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline?
The InChIKey is SOZVRBXNCUTMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN2O2/c1-21(2)15-7-3-13(4-8-15)17-11-20-18(23-17)14-5-9-16(10-6-14)22-12-19/h3-11H,12H2,1-2H3.
What are the key properties of 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline?
4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline has a molecular weight of 312.34 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-(fluoromethoxy)phenyl]-1,3-oxazol-5-yl]-N,N-dimethylaniline is sourced from PubChem (CID 67094230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).